Difference between revisions of "ALL-TRANS-HEXAPRENYL-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_010570 == * left end position: ** 8898924 * transcription direction: ** NEGATIVE * right end position: ** 8913210 * centisome position: ** 86.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == * smiles: ** CC(C)=CCCC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K |
− | * | + | * common name: |
− | ** | + | ** all-trans-hexaprenyl diphosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 583.66 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** hexaprenyl-diphosphate |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-9003]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246217 25246217] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58179 58179] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01230 C01230] | |
− | {{#set: | + | * HMDB : HMDB12188 |
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K}} | ||
+ | {{#set: common name=all-trans-hexaprenyl diphosphate}} | ||
+ | {{#set: molecular weight=583.66 }} | ||
+ | {{#set: common name=hexaprenyl-diphosphate}} | ||
+ | {{#set: consumed by=RXN-9003}} |
Latest revision as of 20:56, 21 March 2018
Contents
Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- inchi key:
- InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K
- common name:
- all-trans-hexaprenyl diphosphate
- molecular weight:
- 583.66
- Synonym(s):
- hexaprenyl-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.