Difference between revisions of "CPD-6994"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-13_003170 == * left end position: ** 4906017 * transcription direction: ** POSITIVE * right end position: ** 4931862 * centisome position: ** 70.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == |
| − | * | + | * smiles: |
| − | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M |
| − | * | + | * common name: |
| − | ** | + | ** (2S)-eriodictyol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 287.248 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-7775]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631] |
| + | * HMDB : HMDB05810 | ||
| + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}} | ||
| + | {{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}} | ||
| + | {{#set: common name=(2S)-eriodictyol}} | ||
| + | {{#set: molecular weight=287.248 }} | ||
| + | {{#set: consumed by=RXN-7775}} | ||
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite CPD-6994
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
- inchi key:
- InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
- common name:
- (2S)-eriodictyol
- molecular weight:
- 287.248
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)" cannot be used as a page name in this wiki.
