Difference between revisions of "CPD-19171"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADPREDUCT-RXN ADPREDUCT-RXN] == * direction: ** REVERSIBLE * common name: ** ADP reductase ** Ribon...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19171 CPD-19171] == * smiles: ** CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADPREDUCT-RXN ADPREDUCT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19171 CPD-19171] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J
 
* common name:
 
* common name:
−
** ADP reductase
+
** (S)-3-hydroxy-(9Z)-octadecenoyl-CoA
−
** Ribonucleoside-diphosphate reductase small chain
+
* molecular weight:
−
** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
+
** 1043.952   
−
** EsV-1-128
+
−
** EsV-1-180
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-3-hydroxy-18:1-Δ9-CoA
 +
** (S)-3-hydroxy-9-cis-octadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17777]]
−
** 1 [[DADP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Ox-Thioredoxin]][c] '''<=>''' 1 [[Red-Thioredoxin]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-17776]]
−
** 1 dADP[c] '''+''' 1 H2O[c] '''+''' 1 an oxidized thioredoxin[c] '''<=>''' 1 a reduced thioredoxin[c] '''+''' 1 ADP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-17_003700]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-11_002180]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-06_005120]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-11_002170]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-21_002920]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-19_000440]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-06_005570]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7227]], adenosine deoxyribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7227 PWY-7227]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28034 28034]
+
{{#set: inchi key=InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J}}
−
* LIGAND-RXN:
+
{{#set: common name=(S)-3-hydroxy-(9Z)-octadecenoyl-CoA}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R02017 R02017]
+
{{#set: molecular weight=1043.952    }}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=(S)-3-hydroxy-18:1-&Delta;9-CoA|(S)-3-hydroxy-9-cis-octadecenoyl-CoA}}
−
{{#set: common name=ADP reductase}}
+
{{#set: consumed by=RXN-17777}}
−
{{#set: common name=Ribonucleoside-diphosphate reductase small chain}}
+
{{#set: produced by=RXN-17776}}
−
{{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
+
−
{{#set: common name=EsV-1-128}}
+
−
{{#set: common name=EsV-1-180}}
+
−
{{#set: ec number=EC-1.17.4.1}}
+
−
{{#set: gene associated=Ec-17_003700|Ec-11_002180|Ec-06_005120|Ec-11_002170|Ec-21_002920|Ec-19_000440|Ec-06_005570}}
+
−
{{#set: in pathway=PWY-7220|PWY-7227}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-19171

  • smiles:
    • CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J
  • common name:
    • (S)-3-hydroxy-(9Z)-octadecenoyl-CoA
  • molecular weight:
    • 1043.952
  • Synonym(s):
    • (S)-3-hydroxy-18:1-Δ9-CoA
    • (S)-3-hydroxy-9-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-19171&oldid=30417"