|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCOKIN-RXN GLUCOKIN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O) |
| + | * inchi key: |
| + | ** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N |
| * common name: | | * common name: |
− | ** glucokinase | + | ** XLLG xyloglucan oligosaccharide |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.7.1.1 EC-2.7.1.1] | + | ** 1387.215 |
− | ** [http://enzyme.expasy.org/EC/2.7.1.2 EC-2.7.1.2]
| + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-12400]] |
− | ** 1 [[Glucopyranose]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[D-glucopyranose-6-phosphate]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 D-glucopyranose[c] '''+''' 1 ATP[c] '''=>''' 1 D-glucopyranose 6-phosphate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-27_005030]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | == Pathways == | + | |
− | * [[TREDEGLOW-PWY]], trehalose degradation I (low osmolarity): [http://metacyc.org/META/NEW-IMAGE?object=TREDEGLOW-PWY TREDEGLOW-PWY]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
| + | |
− | ** '''3''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY0-1182]], trehalose degradation II (trehalase): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1182 PWY0-1182]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-7385]], 1,3-propanediol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7238]], sucrose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7238 PWY-7238]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''12''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[PWY-5514]], UDP-N-acetyl-D-galactosamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5514 PWY-5514]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[GLUCOSE1PMETAB-PWY]], glucose and glucose-1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-621]], sucrose degradation III (sucrose invertase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-2722]], trehalose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2722 PWY-2722]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-2723]], trehalose degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''13''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-5661]], GDP-glucose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5661 PWY-5661]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17825 17825] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189] |
− | * LIGAND-RXN:
| + | {{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01786 R01786]
| + | {{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00299 R00299]
| + | {{#set: common name=XLLG xyloglucan oligosaccharide}} |
− | * UNIPROT:
| + | {{#set: molecular weight=1387.215 }} |
− | ** [http://www.uniprot.org/uniprot/P0A6V8 P0A6V8]
| + | {{#set: consumed by=RXN-12400}} |
− | ** [http://www.uniprot.org/uniprot/P21908 P21908]
| + | |
− | ** [http://www.uniprot.org/uniprot/P64254 P64254]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8XDH5 Q8XDH5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8XDH4 Q8XDH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CE25 Q9CE25]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52792 P52792]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9V2Z6 Q9V2Z6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M537 Q7M537]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17709 P17709]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04409 Q04409]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92407 Q92407]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31392 O31392]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=glucokinase}} | + | |
− | {{#set: ec number=EC-2.7.1.1}}
| + | |
− | {{#set: ec number=EC-2.7.1.2}}
| + | |
− | {{#set: gene associated=Ec-27_005030}} | + | |
− | {{#set: in pathway=TREDEGLOW-PWY|GLYCOCAT-PWY|PWY0-1182|PWY-7385|PWY-7238|P124-PWY|PWY-5514|ANAGLYCOLYSIS-PWY|GLUCOSE1PMETAB-PWY|PWY-621|PWY-2722|PWY-2723|P122-PWY|PWY-5661}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |