Difference between revisions of "Ec-12 003100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] == * smiles: ** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene Ec-12_003100 == * left end position: ** 2867120 * transcription direction: ** POSITIVE * right end position: ** 2877287 * centisome position: ** 34.3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] ==
+
== Gene Ec-12_003100 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2867120
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(11Z)-octadecenoyl-CoA
+
** 2877287
−
* molecular weight:
+
* centisome position:
−
** 1043.952    
+
** 34.39422    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-18:1-Δ11-CoA
+
** Esi_0264_0028
−
** (S)-3-hydroxy-11-cis-octadecenoyl-CoA
+
** Esi0264_0028
 +
** CGL
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17786]]
+
* Reaction: [[CYSTHIOCYS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17785]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[HOMOSERDEAM-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[LCYSDESULF-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[METBALT-RXN]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[O-SUCCHOMOSERLYASE-RXN]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-14048]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14049]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15128]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15129]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15130]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[SULFOCYS-RXN]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[HOMOCYSDEGR-PWY]]
 +
* [[HOMOSER-METSYN-PWY]]
 +
* [[PWY-801]]
 +
* [[LCYSDEG-PWY]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=2867120}}
−
{{#set: inchi key=InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(S)-3-hydroxy-(11Z)-octadecenoyl-CoA}}
+
{{#set: right end position=2877287}}
−
{{#set: molecular weight=1043.952   }}
+
{{#set: centisome position=34.39422   }}
−
{{#set: common name=(S)-3-hydroxy-18:1-Δ11-CoA|(S)-3-hydroxy-11-cis-octadecenoyl-CoA}}
+
{{#set: common name=Esi_0264_0028|Esi0264_0028|CGL}}
−
{{#set: consumed by=RXN-17786}}
+
{{#set: reaction associated=CYSTHIOCYS-RXN|HOMOSERDEAM-RXN|LCYSDESULF-RXN|METBALT-RXN|O-SUCCHOMOSERLYASE-RXN|RXN-14048|RXN-14049|RXN-15128|RXN-15129|RXN-15130|SULFOCYS-RXN}}
−
{{#set: produced by=RXN-17785}}
+
{{#set: pathway associated=HOMOCYSDEGR-PWY|HOMOSER-METSYN-PWY|PWY-801|LCYSDEG-PWY}}

Latest revision as of 19:56, 21 March 2018

Gene Ec-12_003100

  • left end position:
    • 2867120
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2877287
  • centisome position:
    • 34.39422
  • Synonym(s):
    • Esi_0264_0028
    • Esi0264_0028
    • CGL

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_003100&oldid=30460"