Difference between revisions of "CPD-4578"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4578 CPD-4578] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4578 CPD-4578] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N |
* common name: | * common name: | ||
− | ** 3- | + | ** 3-dehydro-4-methylzymosterol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 396.655 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4α-methyl-5α-cholesta-8,24-dien-3-one |
− | + | ** 3-keto-4-methylzymosterol | |
− | + | ||
− | + | ||
− | + | ||
− | ** 3- | + | |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN66-313]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15816 C15816] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50593 50593] |
− | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC50593 |
− | {{#set: smiles=C( | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298939 22298939] |
− | {{#set: common name=3- | + | * HMDB : HMDB06838 |
− | {{#set: molecular weight= | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N}} |
− | {{#set: | + | {{#set: common name=3-dehydro-4-methylzymosterol}} |
+ | {{#set: molecular weight=396.655 }} | ||
+ | {{#set: common name=4α-methyl-5α-cholesta-8,24-dien-3-one|3-keto-4-methylzymosterol}} | ||
+ | {{#set: produced by=RXN66-313}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD-4578
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N
- common name:
- 3-dehydro-4-methylzymosterol
- molecular weight:
- 396.655
- Synonym(s):
- 4α-methyl-5α-cholesta-8,24-dien-3-one
- 3-keto-4-methylzymosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.