Difference between revisions of "Ec-03 004860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Ec-03_004860 == * left end position: ** 5777504 * transcription direction: ** POSITIVE * right end position: ** 5791703 * centisome position: ** 88.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Gene Ec-03_004860 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5777504
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
+
** 5791703
−
* molecular weight:
+
* centisome position:
−
** 967.814    
+
** 88.49448    
 
* Synonym(s):
 
* Synonym(s):
−
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
+
** Esi_0050_0076
 +
** Esi0050_0076
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-14796]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7184]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5777504}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=5791703}}
−
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
+
{{#set: centisome position=88.49448   }}
−
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
+
{{#set: common name=Esi_0050_0076|Esi0050_0076}}
−
{{#set: molecular weight=967.814   }}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}}
−
{{#set: produced by=RXN-14796}}
+

Latest revision as of 19:57, 21 March 2018

Gene Ec-03_004860

  • left end position:
    • 5777504
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5791703
  • centisome position:
    • 88.49448
  • Synonym(s):
    • Esi_0050_0076
    • Esi0050_0076

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_004860&oldid=30488"