Difference between revisions of "CPD1F-437"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_004090 == * left end position: ** 4631852 * transcription direction: ** NEGATIVE * right end position: ** 4635910 * centisome position: ** 82.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] == * smiles: ** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M |
− | * | + | * common name: |
− | ** | + | ** quercetin-3-glucoside |
− | * | + | * molecular weight: |
− | ** | + | ** 463.374 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** quercetin-3-O-β-D-glucoside |
− | ** | + | ** isoquercetin |
+ | ** isoquercitrin | ||
+ | ** isotrifoliin | ||
+ | ** glucosyl 3-quercetin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN1F-462]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203368 25203368] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28299 28299] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05623 C05623] |
+ | * HMDB : HMDB37362 | ||
+ | {{#set: smiles=C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))}} | ||
+ | {{#set: inchi key=InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M}} | ||
+ | {{#set: common name=quercetin-3-glucoside}} | ||
+ | {{#set: molecular weight=463.374 }} | ||
+ | {{#set: common name=quercetin-3-O-β-D-glucoside|isoquercetin|isoquercitrin|isotrifoliin|glucosyl 3-quercetin}} | ||
+ | {{#set: produced by=RXN1F-462}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD1F-437
- smiles:
- C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
- inchi key:
- InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M
- common name:
- quercetin-3-glucoside
- molecular weight:
- 463.374
- Synonym(s):
- quercetin-3-O-β-D-glucoside
- isoquercetin
- isoquercitrin
- isotrifoliin
- glucosyl 3-quercetin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))" cannot be used as a page name in this wiki.