Difference between revisions of "Ec-28 003470"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * inchi key: ** InChIKey=PFNFFQ...") |
(Created page with "Category:Gene == Gene Ec-28_003470 == * left end position: ** 3283382 * transcription direction: ** POSITIVE * right end position: ** 3301626 * centisome position: ** 86.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_003470 == |
− | * | + | * left end position: |
− | ** | + | ** 3283382 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3301626 |
− | * | + | * centisome position: |
− | ** | + | ** 86.655174 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0009_0060 |
− | ** | + | ** Esi0009_0060 |
− | ** | + | ** PPC |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPCARBOX-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-5913]] | ||
+ | * [[PWY-1622]] | ||
+ | * [[PWYQT-4429]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-241]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[PWY-7124]] | ||
+ | * [[PWY-6146]] | ||
+ | * [[FERMENTATION-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3283382}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3301626}} | |
− | + | {{#set: centisome position=86.655174 }} | |
− | + | {{#set: common name=Esi_0009_0060|Esi0009_0060|PPC}} | |
− | + | {{#set: reaction associated=PEPCARBOX-RXN}} | |
− | + | {{#set: pathway associated=PWY-5913|PWY-1622|PWYQT-4429|PWY-7115|PWY-241|P23-PWY|PWY-7117|PWY-6549|PWY-6142|PWY-7124|PWY-6146|FERMENTATION-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:57, 21 March 2018
Gene Ec-28_003470
- left end position:
- 3283382
- transcription direction:
- POSITIVE
- right end position:
- 3301626
- centisome position:
- 86.655174
- Synonym(s):
- Esi_0009_0060
- Esi0009_0060
- PPC
Reactions associated
- Reaction: PEPCARBOX-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-5913
- PWY-1622
- PWYQT-4429
- PWY-7115
- PWY-241
- P23-PWY
- PWY-7117
- PWY-6549
- PWY-6142
- PWY-7124
- PWY-6146
- FERMENTATION-PWY