Difference between revisions of "2.4.1.101-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.101-RXN 2.4.1.101-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Alpha-1,3-mannosyl-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.101-RXN 2.4.1.101-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase, family GT13 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.101 EC-2.4.1.101] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Mannosyl5-N-Glycans]][c] '''+''' 1 [[UDP-N-ACETYL-D-GLUCOSAMINE]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Mannosyl5-N-acetyl-glucosamine2-R]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a (mannosyl)5-N-glycan[c] '''+''' 1 UDP-N-acetyl-α-D-glucosamine[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 a (mannosyl)5-(N-acetylglucosaminyl)-N-glycan[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Ec-23_001370]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-08_002720]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7426]], mannosyl-glycoprotein N-acetylglucosaminyltransferases: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7426 PWY-7426] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11456 11456] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P27115 P27115] |
− | * | + | ** [http://www.uniprot.org/uniprot/P27808 P27808] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q09325 Q09325] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9XGM8 Q9XGM8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q21450 Q21450] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q11068 Q11068] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9GPA3 Q9GPA3] |
− | * | + | ** [http://www.uniprot.org/uniprot/P26572 P26572] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase, family GT13}} |
− | {{#set: | + | {{#set: ec number=EC-2.4.1.101}} |
− | {{#set: | + | {{#set: gene associated=Ec-23_001370|Ec-08_002720}} |
− | {{#set: | + | {{#set: in pathway=PWY-7426}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:57, 21 March 2018
Contents
Reaction 2.4.1.101-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase, family GT13
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Mannosyl5-N-Glycans[c] + 1 UDP-N-ACETYL-D-GLUCOSAMINE[c] => 1 UDP[c] + 1 PROTON[c] + 1 Mannosyl5-N-acetyl-glucosamine2-R[c]
- With common name(s):
- 1 a (mannosyl)5-N-glycan[c] + 1 UDP-N-acetyl-α-D-glucosamine[c] => 1 UDP[c] + 1 H+[c] + 1 a (mannosyl)5-(N-acetylglucosaminyl)-N-glycan[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-23_001370
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-08_002720
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7426, mannosyl-glycoprotein N-acetylglucosaminyltransferases: PWY-7426
- 7 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links