Difference between revisions of "Ec-25 003640"

Latest revision as of 19:57, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+== Gene Ec-25_003640 ==
-* smiles:
-** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J
-* common name:
-** (5Z)-dodecenoyl-CoA
-* molecular weight:
-** 943.792
 * Synonym(s):
-** 12:1-&Delta;5-CoA
+** Esi_0378_0021
-** cis-5-tetradecenoyl-CoA
+** Esi0378_0021
-** 12:1(n-7)-CoA
-** (5Z)-tetradec-5-enoyl-CoA
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-17796]]
+* Reaction: [[RXN-8443]]
-== Reaction(s) known to produce the compound ==
+** Source: [[orthology-aragem]]
-== Reaction(s) of unknown directionality ==
+== Pathways associated ==
+* [[PWY-5381]]
 == External links  ==
-{{#set: smiles=CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: common name=Esi_0378_0021|Esi0378_0021}}
-{{#set: inchi key=InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J}}
+{{#set: reaction associated=RXN-8443}}
-{{#set: common name=(5Z)-dodecenoyl-CoA}}
+{{#set: pathway associated=PWY-5381}}
-{{#set: molecular weight=943.792    }}
-{{#set: common name=12:1-&Delta;5-CoA|cis-5-tetradecenoyl-CoA|12:1(n-7)-CoA|(5Z)-tetradec-5-enoyl-CoA}}
-{{#set: consumed by=RXN-17796}}