Difference between revisions of "Ec-13 004610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * common name: ** di-homo-&g...") |
(Created page with "Category:Gene == Gene Ec-13_004610 == * Synonym(s): ** Esi_0106_0084 ** Esi0106_0084 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_004610 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0106_0084 |
− | ** | + | ** Esi0106_0084 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-8443]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0106_0084|Esi0106_0084}} | |
− | + | {{#set: reaction associated=RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:57, 21 March 2018
Gene Ec-13_004610
- Synonym(s):
- Esi_0106_0084
- Esi0106_0084
Reactions associated
- Reaction: RXN-8443
- Source: orthology-aragem