Difference between revisions of "CPD-7004"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-13_002970 == * left end position: ** 4690786 * transcription direction: ** POSITIVE * right end position: ** 4697483 * centisome position: ** 67.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-13_002970 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
−
* left end position:
+
* smiles:
−
** 4690786
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
−
* right end position:
+
* common name:
−
** 4697483
+
** dihydrogeranylgeranyl chlorophyll a
−
* centisome position:
+
* molecular weight:
−
** 67.62695    
+
** 888.463    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0096_0018
+
** dihydrogeranylgeranyl-chl a
−
** Esi0096_0018
+
** dihydroGG-chl a
 +
** dihydroGG-chlorophyll a
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
* [[RXN-7665]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN-7664]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4690786}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
−
{{#set: right end position=4697483}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
{{#set: centisome position=67.62695   }}
+
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
−
{{#set: common name=Esi_0096_0018|Esi0096_0018}}
+
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
−
{{#set: reaction associated=RXN-15556}}
+
{{#set: molecular weight=888.463   }}
−
{{#set: pathway associated=PWY-7511}}
+
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
 +
{{#set: consumed by=RXN-7665}}
 +
{{#set: produced by=RXN-7664}}

Latest revision as of 19:58, 21 March 2018

Metabolite CPD-7004

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • inchi key:
    • InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
  • common name:
    • dihydrogeranylgeranyl chlorophyll a
  • molecular weight:
    • 888.463
  • Synonym(s):
    • dihydrogeranylgeranyl-chl a
    • dihydroGG-chl a
    • dihydroGG-chlorophyll a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7004&oldid=30606"