Difference between revisions of "Ec-13 004810"

Latest revision as of 19:58, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
+== Gene Ec-13_004810 ==
-* smiles:
-** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
-* common name:
-** (2E,9Z)-octadecenoyl-CoA
-* molecular weight:
-** 1025.937
 * Synonym(s):
-** 18:2-&Delta;2,&Delta;9-CoA
+** Esi_0450_0002
-** 2-trans,9-cis-octadecenoyl-CoA
+** Esi0450_0002
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-17776]]
+* Reaction: [[RXN-8443]]
-== Reaction(s) known to produce the compound ==
+** Source: [[orthology-aragem]]
-* [[RXN-17775]]
+== Pathways associated ==
-== Reaction(s) of unknown directionality ==
+* [[PWY-5381]]
 == External links  ==
-{{#set: smiles=CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: common name=Esi_0450_0002|Esi0450_0002}}
-{{#set: inchi key=InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J}}
+{{#set: reaction associated=RXN-8443}}
-{{#set: common name=(2E,9Z)-octadecenoyl-CoA}}
+{{#set: pathway associated=PWY-5381}}
-{{#set: molecular weight=1025.937    }}
-{{#set: common name=18:2-&Delta;2,&Delta;9-CoA|2-trans,9-cis-octadecenoyl-CoA}}
-{{#set: consumed by=RXN-17776}}
-{{#set: produced by=RXN-17775}}