Difference between revisions of "DAMP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-26_000570 == * left end position: ** 847619 * transcription direction: ** NEGATIVE * right end position: ** 854226 * centisome position: ** 12.875...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == |
− | * | + | * smiles: |
− | ** | + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L |
− | * | + | * common name: |
− | ** | + | ** dAMP |
− | * | + | * molecular weight: |
− | ** | + | ** 329.208 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2'-deoxyadenosine 5'-phosphate |
− | ** | + | ** deoxyadenosine-phosphate |
+ | ** 2'-deoxyadenosine 5''-monophosphate | ||
+ | ** 2'-dAMP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-14195]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-14215]] |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 653-63-4 |
− | {{#set: | + | * BIGG : 34735 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22848660 22848660] |
− | {{#set: common name= | + | * HMDB : HMDB00905 |
− | {{#set: reaction associated= | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00360 C00360] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.18735032.html 18735032] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58245 58245] | ||
+ | * METABOLIGHTS : MTBLC58245 | ||
+ | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L}} | ||
+ | {{#set: common name=dAMP}} | ||
+ | {{#set: molecular weight=329.208 }} | ||
+ | {{#set: common name=2'-deoxyadenosine 5'-phosphate|deoxyadenosine-phosphate|2'-deoxyadenosine 5''-monophosphate|2'-dAMP}} | ||
+ | {{#set: produced by=RXN-14195}} | ||
+ | {{#set: reversible reaction associated=RXN-14215}} |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite DAMP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O
- inchi key:
- InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L
- common name:
- dAMP
- molecular weight:
- 329.208
- Synonym(s):
- 2'-deoxyadenosine 5'-phosphate
- deoxyadenosine-phosphate
- 2'-deoxyadenosine 5-monophosphate
- 2'-dAMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 653-63-4
- BIGG : 34735
- PUBCHEM:
- HMDB : HMDB00905
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58245
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.