Difference between revisions of "CPD-204"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-24_000510 == * Synonym(s): ** Esi_0019_0013 ** Esi0019_0013 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-24_000510 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] ==
 +
* smiles:
 +
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
 +
* common name:
 +
** gibberellin A8
 +
* molecular weight:
 +
** 363.386   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0019_0013
+
** GA8
** Esi0019_0013
+
** 2β-hydroxygibberellin 1
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[aragem]]
+
* [[RXN-115]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0019_0013|Esi0019_0013}}
+
* PUBCHEM:
{{#set: reaction associated=RXN-8443}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521]
{{#set: pathway associated=PWY-5381}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}}
 +
{{#set: common name=gibberellin A8}}
 +
{{#set: molecular weight=363.386    }}
 +
{{#set: common name=GA8|2β-hydroxygibberellin 1}}
 +
{{#set: produced by=RXN-115}}

Latest revision as of 19:58, 21 March 2018

Metabolite CPD-204

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
  • common name:
    • gibberellin A8
  • molecular weight:
    • 363.386
  • Synonym(s):
    • GA8
    • 2β-hydroxygibberellin 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.