Difference between revisions of "RXN-10814"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10814 RXN-10814] == * direction: ** REVERSIBLE * common name: ** Aspartate Aminotransferase **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10814 RXN-10814] ==
−
* smiles:
+
* direction:
−
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
+
 
* common name:
 
* common name:
−
** 5-hydroxyferulate
+
** Aspartate Aminotransferase
−
* molecular weight:
+
** aspartate aminotransferase
−
** 209.178   
+
** Pyridoxal phosphate-dependent transferase, major region, subdomain 1
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.6.1.1 EC-2.6.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxy ferulic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-3422]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[PHE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[PHENYL-PYRUVATE]][c]
−
* [[RXN-1121]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 2-oxoglutarate[c] '''+''' 1 L-phenylalanine[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 2-oxo-3-phenylpropanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_003500]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-03_003270]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-01_007480]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6318]], L-phenylalanine degradation IV (mammalian, via side chain): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6318 PWY-6318]
 +
** '''4''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
+
{{#set: common name=Aspartate Aminotransferase}}
−
* LIGAND-CPD:
+
{{#set: common name=aspartate aminotransferase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
+
{{#set: common name=Pyridoxal phosphate-dependent transferase, major region, subdomain 1}}
−
* HMDB : HMDB35484
+
{{#set: ec number=EC-2.6.1.1}}
−
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
+
{{#set: gene associated=Ec-23_003500|Ec-03_003270|Ec-01_007480}}
−
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
+
{{#set: in pathway=PWY-6318}}
−
{{#set: common name=5-hydroxyferulate}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=209.178    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=5-hydroxy ferulic acid}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-3422}}
+
−
{{#set: produced by=RXN-1121}}
+

Latest revision as of 19:58, 21 March 2018

Reaction RXN-10814

  • direction:
    • REVERSIBLE
  • common name:
    • Aspartate Aminotransferase
    • aspartate aminotransferase
    • Pyridoxal phosphate-dependent transferase, major region, subdomain 1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 2-oxoglutarate[c] + 1 L-phenylalanine[c] <=> 1 L-glutamate[c] + 1 2-oxo-3-phenylpropanoate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6318, L-phenylalanine degradation IV (mammalian, via side chain): PWY-6318
    • 4 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10814&oldid=30629"