Difference between revisions of "5-HYDROXY-FERULIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_007560 == * left end position: ** 6458589 * transcription direction: ** POSITIVE * right end position: ** 6465626 * centisome position: ** 62.5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_007560 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
−
* left end position:
+
* smiles:
−
** 6458589
+
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
−
* right end position:
+
* common name:
−
** 6465626
+
** 5-hydroxyferulate
−
* centisome position:
+
* molecular weight:
−
** 62.5903    
+
** 209.178    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0002_0147
+
** 5-hydroxy ferulic acid
−
** Esi0002_0147
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[6.3.2.25-RXN]]
+
* [[RXN-3422]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN-1121]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6458589}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
−
{{#set: right end position=6465626}}
+
* LIGAND-CPD:
−
{{#set: centisome position=62.5903   }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
−
{{#set: common name=Esi_0002_0147|Esi0002_0147}}
+
* HMDB : HMDB35484
−
{{#set: reaction associated=6.3.2.25-RXN}}
+
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
 +
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
 +
{{#set: common name=5-hydroxyferulate}}
 +
{{#set: molecular weight=209.178   }}
 +
{{#set: common name=5-hydroxy ferulic acid}}
 +
{{#set: consumed by=RXN-3422}}
 +
{{#set: produced by=RXN-1121}}

Latest revision as of 20:58, 21 March 2018

Metabolite 5-HYDROXY-FERULIC-ACID

  • smiles:
    • COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
  • inchi key:
    • InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
  • common name:
    • 5-hydroxyferulate
  • molecular weight:
    • 209.178
  • Synonym(s):
    • 5-hydroxy ferulic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-HYDROXY-FERULIC-ACID&oldid=30630"