Difference between revisions of "5-HYDROXY-FERULIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-19_000120 == * Synonym(s): ** Esi_0328_0037 ** Esi0328_0037 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-19_000120 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
 +
* smiles:
 +
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
 +
* inchi key:
 +
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
 +
* common name:
 +
** 5-hydroxyferulate
 +
* molecular weight:
 +
** 209.178   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0328_0037
+
** 5-hydroxy ferulic acid
** Esi0328_0037
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[RXN-3422]]
** [[pantograph]]-[[aragem]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN-1121]]
* [[PWY-5381]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0328_0037|Esi0328_0037}}
+
* PUBCHEM:
{{#set: reaction associated=RXN-8443}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
{{#set: pathway associated=PWY-5381}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
 +
* HMDB : HMDB35484
 +
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
 +
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
 +
{{#set: common name=5-hydroxyferulate}}
 +
{{#set: molecular weight=209.178    }}
 +
{{#set: common name=5-hydroxy ferulic acid}}
 +
{{#set: consumed by=RXN-3422}}
 +
{{#set: produced by=RXN-1121}}

Latest revision as of 19:58, 21 March 2018

Metabolite 5-HYDROXY-FERULIC-ACID

  • smiles:
    • COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
  • inchi key:
    • InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
  • common name:
    • 5-hydroxyferulate
  • molecular weight:
    • 209.178
  • Synonym(s):
    • 5-hydroxy ferulic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)" cannot be used as a page name in this wiki.