Difference between revisions of "CPD-471"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-471 CPD-471] == * smiles: ** CC(C[N+])C([O-])=O * inchi key: ** InChIKey=QCHPKSFMDHPSNR-GSV...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-471 CPD-471] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** CC(C[N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QCHPKSFMDHPSNR-GSVOUGTGSA-N |
* common name: | * common name: | ||
| − | ** | + | ** (R)-3-amino-2-methylpropanoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 103.121 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-3-amino-isobutanoate |
| − | + | ** 2-methyl-β-alanine | |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11210]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01205 C01205] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57731 57731] | ||
| + | * METABOLIGHTS : MTBLC57731 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971064 6971064] |
| − | * | + | * HMDB : HMDB02299 |
| − | + | {{#set: smiles=CC(C[N+])C([O-])=O}} | |
| − | {{#set: smiles=C | + | {{#set: inchi key=InChIKey=QCHPKSFMDHPSNR-GSVOUGTGSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=(R)-3-amino-2-methylpropanoate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=103.121 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=D-3-amino-isobutanoate|2-methyl-β-alanine}} |
| − | {{#set: common name= | + | {{#set: produced by=RXN-11210}} |
| − | {{#set: produced by=RXN- | + | |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite CPD-471
- smiles:
- CC(C[N+])C([O-])=O
- inchi key:
- InChIKey=QCHPKSFMDHPSNR-GSVOUGTGSA-N
- common name:
- (R)-3-amino-2-methylpropanoate
- molecular weight:
- 103.121
- Synonym(s):
- D-3-amino-isobutanoate
- 2-methyl-β-alanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C[N+])C([O-])=O" cannot be used as a page name in this wiki.
