Difference between revisions of "Ec-09 003670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene Ec-09_003670 == * left end position: ** 4175548 * transcription direction: ** POSITIVE * right end position: ** 4176248 * centisome position: ** 74.3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] ==
+
== Gene Ec-09_003670 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 4175548
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** OPC6-trans-2-enoyl-CoA
+
** 4176248
−
* molecular weight:
+
* centisome position:
−
** 1009.851    
+
** 74.38853    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0021_0028
 +
** Esi0021_0028
 +
** GST N-ter
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10704]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-10706]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4175548}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237321 44237321]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: right end position=4176248}}
−
{{#set: inchi key=InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J}}
+
{{#set: centisome position=74.38853    }}
−
{{#set: common name=OPC6-trans-2-enoyl-CoA}}
+
{{#set: common name=Esi_0021_0028|Esi0021_0028|GST N-ter}}
−
{{#set: molecular weight=1009.851    }}
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: consumed by=RXN-10704}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: produced by=RXN-10706}}
+

Latest revision as of 20:58, 21 March 2018

Gene Ec-09_003670

  • left end position:
    • 4175548
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4176248
  • centisome position:
    • 74.38853
  • Synonym(s):
    • Esi_0021_0028
    • Esi0021_0028
    • GST N-ter

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_003670&oldid=30675"