Difference between revisions of "Ec-08 002170"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * inchi key: ** InChIKey=LRFVTYWOQ...") |
(Created page with "Category:Gene == Gene Ec-08_002170 == * left end position: ** 2093470 * transcription direction: ** POSITIVE * right end position: ** 2097000 * centisome position: ** 31.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_002170 == |
− | * | + | * left end position: |
− | ** | + | ** 2093470 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2097000 |
− | * | + | * centisome position: |
− | ** | + | ** 31.25951 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0007_0130 |
+ | ** Esi0007_0130 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.14.11.2-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | * Reaction: [[RXN490-3641]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2093470}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2097000}} | |
− | + | {{#set: centisome position=31.25951 }} | |
− | + | {{#set: common name=Esi_0007_0130|Esi0007_0130}} | |
− | + | {{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-08_002170
- left end position:
- 2093470
- transcription direction:
- POSITIVE
- right end position:
- 2097000
- centisome position:
- 31.25951
- Synonym(s):
- Esi_0007_0130
- Esi0007_0130
Reactions associated
- Reaction: 1.14.11.2-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN490-3641
- Source: orthology-aragem