Difference between revisions of "Ec-06 007300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * smiles: ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Gene == Gene Ec-06_007300 == * left end position: ** 4971520 * transcription direction: ** NEGATIVE * right end position: ** 4976838 * centisome position: ** 56.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] ==
+
== Gene Ec-06_007300 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** 4971520
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** OPC4-trans-2-enoyl-CoA
+
** 4976838
−
* molecular weight:
+
* centisome position:
−
** 981.797    
+
** 56.76704    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0411_0021
 +
** Esi0411_0021
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10705]]
+
* Reaction: [[ARYL-SULFOTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-10707]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-10614]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10615]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10777]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10782]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11058]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11059]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15587]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15588]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15589]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN6666-9]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY6666-2]]
 +
* [[PWY-6261]]
 +
* [[PWY-6313]]
 +
* [[PWY-6398]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4971520}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237329 44237329]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: right end position=4976838}}
−
{{#set: inchi key=InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J}}
+
{{#set: centisome position=56.76704    }}
−
{{#set: common name=OPC4-trans-2-enoyl-CoA}}
+
{{#set: common name=Esi_0411_0021|Esi0411_0021}}
−
{{#set: molecular weight=981.797    }}
+
{{#set: reaction associated=ARYL-SULFOTRANSFERASE-RXN|RXN-10614|RXN-10615|RXN-10777|RXN-10782|RXN-11058|RXN-11059|RXN-15587|RXN-15588|RXN-15589|RXN6666-9}}
−
{{#set: consumed by=RXN-10705}}
+
{{#set: pathway associated=PWY6666-2|PWY-6261|PWY-6313|PWY-6398}}
−
{{#set: produced by=RXN-10707}}
+

Latest revision as of 20:58, 21 March 2018

Gene Ec-06_007300

  • left end position:
    • 4971520
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4976838
  • centisome position:
    • 56.76704
  • Synonym(s):
    • Esi_0411_0021
    • Esi0411_0021

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_007300&oldid=30683"