Difference between revisions of "Ec-01 010560"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KYNURENATE KYNURENATE] == * smiles: ** C1(C=C2(C(=CC=1)N=C(C(=O)[O-])C=C([O-])2)) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-01_010560 == * left end position: ** 8888076 * transcription direction: ** NEGATIVE * right end position: ** 8894982 * centisome position: ** 86.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_010560 == |
− | * | + | * left end position: |
− | ** | + | ** 8888076 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 8894982 |
− | * | + | * centisome position: |
− | ** | + | ** 86.1345 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0163_0051 |
+ | ** Esi0163_0051 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=8888076}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=8894982}} | |
− | + | {{#set: centisome position=86.1345 }} | |
− | + | {{#set: common name=Esi_0163_0051|Esi0163_0051}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-01_010560
- left end position:
- 8888076
- transcription direction:
- NEGATIVE
- right end position:
- 8894982
- centisome position:
- 86.1345
- Synonym(s):
- Esi_0163_0051
- Esi0163_0051
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome