Difference between revisions of "CPD-520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-21_001700 == * left end position: ** 2761888 * transcription direction: ** NEGATIVE * right end position: ** 2764982 * centisome position: ** 37.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-21_001700 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] ==
−
* left end position:
+
* smiles:
−
** 2761888
+
** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 2764982
+
** quercetin
−
* centisome position:
+
* molecular weight:
−
** 37.423355    
+
** 301.232    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0147_0026
+
** 3,5,7,3',4'-pentahydroxyflavone
−
** Esi0147_0026
+
** 3,5,7,3',4'-pentahydroflavone
−
** PTP
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.3.16-RXN]]
+
* [[RXN1F-462]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN-527]]
−
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***ec-number
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2761888}}
+
* NCI:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9219 9219]
−
{{#set: right end position=2764982}}
+
* CAS : 117-39-5
−
{{#set: centisome position=37.423355   }}
+
* Wikipedia : Quercetin
−
{{#set: common name=Esi_0147_0026|Esi0147_0026|PTP}}
+
* PUBCHEM:
−
{{#set: reaction associated=3.1.3.16-RXN|PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906036 46906036]
 +
* HMDB : HMDB05794
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00389 C00389]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57694 57694]
 +
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))}}
 +
{{#set: inchi key=InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M}}
 +
{{#set: common name=quercetin}}
 +
{{#set: molecular weight=301.232   }}
 +
{{#set: common name=3,5,7,3',4'-pentahydroxyflavone|3,5,7,3',4'-pentahydroflavone}}
 +
{{#set: consumed by=RXN1F-462}}
 +
{{#set: produced by=RXN-527}}

Latest revision as of 20:58, 21 March 2018

Metabolite CPD-520

  • smiles:
    • C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))
  • inchi key:
    • InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M
  • common name:
    • quercetin
  • molecular weight:
    • 301.232
  • Synonym(s):
    • 3,5,7,3',4'-pentahydroxyflavone
    • 3,5,7,3',4'-pentahydroflavone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • NCI:
  • CAS : 117-39-5
  • Wikipedia : Quercetin
  • PUBCHEM:
  • HMDB : HMDB05794
  • LIGAND-CPD:
  • CHEBI:
"C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-520&oldid=30694"