Difference between revisions of "Protein-With-N-Terminal-X-Pro"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-X-Pro Protein-With-N-Terminal-X-Pro] == * common name: ** a peptide wit...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-X-Pro Protein-With-N-Terminal-X-Pro] ==
* smiles:
+
** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
+
* inchi key:
+
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
 
* common name:
 
* common name:
** molybdopterin adenine dinucleotide
+
** a peptide with an N-terminal X-L-proline
* molecular weight:
+
** 721.529   
+
 
* Synonym(s):
 
* Synonym(s):
** adenylated molybdopterin
 
** H2Dtpp-mADP
 
** molybdopterin-AMP
 
** adenylyl-molybdopterin
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8348]]
+
* [[3.4.11.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8344]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a peptide with an N-terminal X-L-proline}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
{{#set: consumed by=3.4.11.1-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))}}
+
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: common name=molybdopterin adenine dinucleotide}}
+
{{#set: molecular weight=721.529    }}
+
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
{{#set: consumed by=RXN-8348}}
+
{{#set: produced by=RXN-8344}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite Protein-With-N-Terminal-X-Pro

  • common name:
    • a peptide with an N-terminal X-L-proline
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links