Difference between revisions of "Ec-27 003020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[...")
 
(Created page with "Category:Gene == Gene Ec-27_003020 == * left end position: ** 2647405 * transcription direction: ** POSITIVE * right end position: ** 2660378 * centisome position: ** 41.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] ==
+
== Gene Ec-27_003020 ==
* smiles:
+
* left end position:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** 2647405
* inchi key:
+
* transcription direction:
** InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J
+
** POSITIVE
* common name:
+
* right end position:
** 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
+
** 2660378
* molecular weight:
+
* centisome position:
** 983.77    
+
** 41.04563    
 
* Synonym(s):
 
* Synonym(s):
** HIP-CoA
+
** Esi_0000_0599
 +
** Esi0000_0599
 +
** MAPK
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12747]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=2647405}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289539 86289539]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=2660378}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78357 78357]
+
{{#set: centisome position=41.04563   }}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: common name=Esi_0000_0599|Esi0000_0599|MAPK}}
{{#set: inchi key=InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: common name=3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
+
{{#set: molecular weight=983.77   }}
+
{{#set: common name=HIP-CoA}}
+
{{#set: consumed by=RXN-12747}}
+

Latest revision as of 20:58, 21 March 2018

Gene Ec-27_003020

  • left end position:
    • 2647405
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2660378
  • centisome position:
    • 41.04563
  • Synonym(s):
    • Esi_0000_0599
    • Esi0000_0599
    • MAPK

Reactions associated

Pathways associated

External links