Difference between revisions of "Ec-23 002110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC...")
 
(Created page with "Category:Gene == Gene Ec-23_002110 == * left end position: ** 2182018 * transcription direction: ** POSITIVE * right end position: ** 2192284 * centisome position: ** 45.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Gene Ec-23_002110 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
+
** 2182018
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** molybdopterin adenine dinucleotide
+
** 2192284
−
* molecular weight:
+
* centisome position:
−
** 721.529    
+
** 45.087982    
 
* Synonym(s):
 
* Synonym(s):
−
** adenylated molybdopterin
+
** Esi_0042_0037
−
** H2Dtpp-mADP
+
** Esi0042_0037
−
** molybdopterin-AMP
+
−
** adenylyl-molybdopterin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8348]]
+
* Reaction: [[1.5.5.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-8344]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN66-550]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2182018}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2192284}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
{{#set: centisome position=45.087982   }}
−
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))}}
+
{{#set: common name=Esi_0042_0037|Esi0042_0037}}
−
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: reaction associated=1.5.5.1-RXN|RXN66-550}}
−
{{#set: common name=molybdopterin adenine dinucleotide}}
+
−
{{#set: molecular weight=721.529   }}
+
−
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
−
{{#set: consumed by=RXN-8348}}
+
−
{{#set: produced by=RXN-8344}}
+

Latest revision as of 19:58, 21 March 2018

Gene Ec-23_002110

  • left end position:
    • 2182018
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2192284
  • centisome position:
    • 45.087982
  • Synonym(s):
    • Esi_0042_0037
    • Esi0042_0037

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-23_002110&oldid=30707"