Difference between revisions of "Ec-18 000430"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...")
 
(Created page with "Category:Gene == Gene Ec-18_000430 == * left end position: ** 398930 * transcription direction: ** NEGATIVE * right end position: ** 401435 * centisome position: ** 8.0975...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Gene Ec-18_000430 ==
−
* smiles:
+
* left end position:
−
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** 398930
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (R)-S-lactoylglutathione
+
** 401435
−
* molecular weight:
+
* centisome position:
−
** 378.376    
+
** 8.097542    
 
* Synonym(s):
 
* Synonym(s):
−
** S-D-lactoylglutathione
+
** Esi_0020_0043
−
** D-lactoylglutathione
+
** Esi0020_0043
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GLYOXII-RXN]]
+
* Reaction: [[RXN-14387]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[GLYOXI-RXN]]
+
== Pathways associated ==
 +
* [[PWY-7250]]
 
== External links  ==
 
== External links  ==
−
* CAS : 25138-66-3
+
{{#set: left end position=398930}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377]
+
{{#set: right end position=401435}}
−
* HMDB : HMDB01066
+
{{#set: centisome position=8.097542   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0020_0043|Esi0020_0043}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451]
+
{{#set: reaction associated=RXN-14387}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-7250}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474]
+
−
* BIGG : 41876
+
−
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}}
+
−
{{#set: common name=(R)-S-lactoylglutathione}}
+
−
{{#set: molecular weight=378.376   }}
+
−
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}}
+
−
{{#set: consumed by=GLYOXII-RXN}}
+
−
{{#set: consumed or produced by=GLYOXI-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Gene Ec-18_000430

  • left end position:
    • 398930
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 401435
  • centisome position:
    • 8.097542
  • Synonym(s):
    • Esi_0020_0043
    • Esi0020_0043

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_000430&oldid=30745"