Difference between revisions of "CPD-464"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == * common name: **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
 +
* smiles:
 +
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
 +
* inchi key:
 +
** InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
 
* common name:
 
* common name:
** a poly-[γ-glutamylcysteine]-glycine
+
** prephytoene diphosphate
 +
* molecular weight:
 +
** 719.897   
 
* Synonym(s):
 
* Synonym(s):
** a phytochelatin
+
** (1R,2R,3R)-prephytoene diphosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.2.15-RXN]]
+
* [[RXNARA-8002]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.2.15-RXN]]
+
* [[2.5.1.32-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a poly-[γ-glutamylcysteine]-glycine}}
+
* PUBCHEM:
{{#set: common name=a phytochelatin}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
{{#set: consumed by=2.3.2.15-RXN}}
+
* CHEBI:
{{#set: produced by=2.3.2.15-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
 +
* HMDB : HMDB03023
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
 +
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K}}
 +
{{#set: common name=prephytoene diphosphate}}
 +
{{#set: molecular weight=719.897    }}
 +
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
 +
{{#set: consumed by=RXNARA-8002}}
 +
{{#set: produced by=2.5.1.32-RXN}}

Latest revision as of 20:59, 21 March 2018

Metabolite CPD-464

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
  • inchi key:
    • InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
  • common name:
    • prephytoene diphosphate
  • molecular weight:
    • 719.897
  • Synonym(s):
    • (1R,2R,3R)-prephytoene diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.