Difference between revisions of "CPD-464"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** prephytoene diphosphate |
+ | * molecular weight: | ||
+ | ** 719.897 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (1R,2R,3R)-prephytoene diphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXNARA-8002]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[2. | + | * [[2.5.1.32-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670] |
− | {{#set: consumed by= | + | * CHEBI: |
− | {{#set: produced by=2. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427] | ||
+ | * HMDB : HMDB03023 | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K}} | ||
+ | {{#set: common name=prephytoene diphosphate}} | ||
+ | {{#set: molecular weight=719.897 }} | ||
+ | {{#set: common name=(1R,2R,3R)-prephytoene diphosphate}} | ||
+ | {{#set: consumed by=RXNARA-8002}} | ||
+ | {{#set: produced by=2.5.1.32-RXN}} |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite CPD-464
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
- inchi key:
- InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
- common name:
- prephytoene diphosphate
- molecular weight:
- 719.897
- Synonym(s):
- (1R,2R,3R)-prephytoene diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.