Difference between revisions of "CPD-464"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_003790 == * left end position: ** 3537051 * transcription direction: ** NEGATIVE * right end position: ** 3542109 * centisome position: ** 53.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-14_003790 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
* left end position:
+
* smiles:
** 3537051
+
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
* right end position:
+
* common name:
** 3542109
+
** prephytoene diphosphate
* centisome position:
+
* molecular weight:
** 53.91494    
+
** 719.897    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0286_0006
+
** (1R,2R,3R)-prephytoene diphosphate
** Esi0286_0006
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CDPDIGLYSYN-RXN]]
+
* [[RXNARA-8002]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[2.5.1.32-RXN]]
* [[RXN0-5515]]
+
== Reaction(s) of unknown directionality ==
** esiliculosus_genome
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-5667]]
+
* [[PWY-5981]]
+
* [[PWY0-1319]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3537051}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
{{#set: right end position=3542109}}
+
* CHEBI:
{{#set: centisome position=53.91494   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
{{#set: common name=Esi_0286_0006|Esi0286_0006}}
+
* LIGAND-CPD:
{{#set: reaction associated=CDPDIGLYSYN-RXN|RXN0-5515}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
{{#set: pathway associated=PWY-5667|PWY-5981|PWY0-1319}}
+
* HMDB : HMDB03023
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
 +
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K}}
 +
{{#set: common name=prephytoene diphosphate}}
 +
{{#set: molecular weight=719.897   }}
 +
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
 +
{{#set: consumed by=RXNARA-8002}}
 +
{{#set: produced by=2.5.1.32-RXN}}

Latest revision as of 19:59, 21 March 2018

Metabolite CPD-464

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
  • inchi key:
    • InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
  • common name:
    • prephytoene diphosphate
  • molecular weight:
    • 719.897
  • Synonym(s):
    • (1R,2R,3R)-prephytoene diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.