Difference between revisions of "CPD-464"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_003790 == * left end position: ** 3537051 * transcription direction: ** NEGATIVE * right end position: ** 3542109 * centisome position: ** 53.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K |
| − | * | + | * common name: |
| − | ** | + | ** prephytoene diphosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 719.897 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (1R,2R,3R)-prephytoene diphosphate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXNARA-8002]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[2.5.1.32-RXN]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427] |
| − | {{#set: | + | * HMDB : HMDB03023 |
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K}} | ||
| + | {{#set: common name=prephytoene diphosphate}} | ||
| + | {{#set: molecular weight=719.897 }} | ||
| + | {{#set: common name=(1R,2R,3R)-prephytoene diphosphate}} | ||
| + | {{#set: consumed by=RXNARA-8002}} | ||
| + | {{#set: produced by=2.5.1.32-RXN}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-464
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
- inchi key:
- InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
- common name:
- prephytoene diphosphate
- molecular weight:
- 719.897
- Synonym(s):
- (1R,2R,3R)-prephytoene diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.
