Difference between revisions of "Ec-00 009240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
(Created page with "Category:Gene == Gene Ec-00_009240 == * left end position: ** 15231882 * transcription direction: ** POSITIVE * right end position: ** 15243543 * centisome position: ** 80...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_009240 == |
− | * | + | * left end position: |
− | ** | + | ** 15231882 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 15243543 |
− | * | + | * centisome position: |
− | ** | + | ** 80.394455 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0676_0005 |
− | ** | + | ** Esi0676_0005 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ADENYL-KIN-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=15231882}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=15243543}} | |
− | + | {{#set: centisome position=80.394455 }} | |
− | + | {{#set: common name=Esi_0676_0005|Esi0676_0005}} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:59, 21 March 2018
Gene Ec-00_009240
- left end position:
- 15231882
- transcription direction:
- POSITIVE
- right end position:
- 15243543
- centisome position:
- 80.394455
- Synonym(s):
- Esi_0676_0005
- Esi0676_0005
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome