Difference between revisions of "2-Me-Branched-234-Sat-FA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] == * common name: ** a 2-methyl branched 2,3...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FA 2-Me-Branched-234-Sat-FA] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 2-methyl branched 2,3,4-saturated fatty acid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-483]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-472]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 2-methyl branched 2,3,4-saturated fatty acid}} | |
− | + | {{#set: consumed by=RXN66-483}} | |
− | + | {{#set: produced by=RXN66-472}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite 2-Me-Branched-234-Sat-FA
- common name:
- a 2-methyl branched 2,3,4-saturated fatty acid
- Synonym(s):