Difference between revisions of "Ec-24 003940"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-24_003940 == * left end position: ** 4319512 * transcription direction: ** POSITIVE * right end position: ** 4336969 * centisome position: ** 86.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_003940 == |
− | * | + | * left end position: |
− | ** | + | ** 4319512 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4336969 |
− | * | + | * centisome position: |
− | ** | + | ** 86.603775 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0109_0076 | ||
+ | ** Esi0109_0076 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4319512}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4336969}} | |
− | + | {{#set: centisome position=86.603775 }} | |
− | + | {{#set: common name=Esi_0109_0076|Esi0109_0076}} | |
− | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Gene Ec-24_003940
- left end position:
- 4319512
- transcription direction:
- POSITIVE
- right end position:
- 4336969
- centisome position:
- 86.603775
- Synonym(s):
- Esi_0109_0076
- Esi0109_0076
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome