Difference between revisions of "CPD-2750"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N |
* common name: | * common name: | ||
− | ** | + | ** trans-3'-hydroxycotinine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 192.217 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN66-161]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.97080.html 97080] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71182 71182] |
− | * | + | * METABOLIGHTS : MTBLC71182 |
− | * | + | * HMDB : HMDB01390 |
− | {{#set: smiles= | + | {{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}} |
− | {{#set: common name= | + | {{#set: common name=trans-3'-hydroxycotinine}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=192.217 }} |
− | {{#set: | + | {{#set: produced by=RXN66-161}} |
− | + |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-2750
- smiles:
- C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N
- common name:
- trans-3'-hydroxycotinine
- molecular weight:
- 192.217
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.