Difference between revisions of "Ec-10 002590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == * smiles: ** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Gene == Gene Ec-10_002590 == * left end position: ** 2729504 * transcription direction: ** NEGATIVE * right end position: ** 2734338 * centisome position: ** 41.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] ==
+
== Gene Ec-10_002590 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 2729504
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** sapienoyl-CoA
+
** 2734338
−
* molecular weight:
+
* centisome position:
−
** 999.899    
+
** 41.986008    
 
* Synonym(s):
 
* Synonym(s):
−
** Δ6-hexadecenoyl-CoA
+
** Esi_0174_0002
−
** (6Z)-hexadec-6-enoyl-CoA
+
** Esi0174_0002
−
** (6Z)-hexadecenoyl-CoA
+
−
** 16:1, n-10, cis-6 hexadecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[INORGPYROPHOSPHAT-RXN]]
−
* [[RXN-16065]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2729504}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627261 71627261]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2734338}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74339 74339]
+
{{#set: centisome position=41.986008   }}
−
{{#set: smiles=CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0174_0002|Esi0174_0002}}
−
{{#set: inchi key=InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J}}
+
{{#set: reaction associated=INORGPYROPHOSPHAT-RXN}}
−
{{#set: common name=sapienoyl-CoA}}
+
−
{{#set: molecular weight=999.899   }}
+
−
{{#set: common name=Δ6-hexadecenoyl-CoA|(6Z)-hexadec-6-enoyl-CoA|(6Z)-hexadecenoyl-CoA|16:1, n-10, cis-6 hexadecenoyl-CoA}}
+
−
{{#set: produced by=RXN-16065}}
+

Latest revision as of 19:59, 21 March 2018

Gene Ec-10_002590

  • left end position:
    • 2729504
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2734338
  • centisome position:
    • 41.986008
  • Synonym(s):
    • Esi_0174_0002
    • Esi0174_0002

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_002590&oldid=30799"