Difference between revisions of "CPD-17313"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_004100 == * left end position: ** 3893339 * transcription direction: ** POSITIVE * right end position: ** 3898074 * centisome position: ** 58.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == * smiles: ** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J |
| − | * | + | * common name: |
| − | ** | + | ** sapienoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 999.899 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Δ6-hexadecenoyl-CoA |
| − | ** | + | ** (6Z)-hexadec-6-enoyl-CoA |
| − | ** | + | ** (6Z)-hexadecenoyl-CoA |
| + | ** 16:1, n-10, cis-6 hexadecenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16065]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627261 71627261] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74339 74339] |
| − | {{#set: common name= | + | {{#set: smiles=CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J}} |
| + | {{#set: common name=sapienoyl-CoA}} | ||
| + | {{#set: molecular weight=999.899 }} | ||
| + | {{#set: common name=Δ6-hexadecenoyl-CoA|(6Z)-hexadec-6-enoyl-CoA|(6Z)-hexadecenoyl-CoA|16:1, n-10, cis-6 hexadecenoyl-CoA}} | ||
| + | {{#set: produced by=RXN-16065}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-17313
- smiles:
- CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J
- common name:
- sapienoyl-CoA
- molecular weight:
- 999.899
- Synonym(s):
- Δ6-hexadecenoyl-CoA
- (6Z)-hexadec-6-enoyl-CoA
- (6Z)-hexadecenoyl-CoA
- 16:1, n-10, cis-6 hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
