Difference between revisions of "Ec-02 001820"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...")
 
(Created page with "Category:Gene == Gene Ec-02_001820 == * Synonym(s): ** Esi_0055_0072 ** Esi0055_0072 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
+
== Gene Ec-02_001820 ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
+
−
* common name:
+
−
** 3-oxoadipyl-CoA
+
−
* molecular weight:
+
−
** 904.605   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-ketoadipyl-CoA
+
** Esi_0055_0072
−
** 3-keto-adipyl-coa
+
** Esi0055_0072
−
** β-ketoadipyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
−
* [[RXN0-2044]]
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0055_0072|Esi0055_0072}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578]
+
{{#set: reaction associated=RXN-8443}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57348 57348]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232]
+
−
* HMDB : HMDB60378
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}}
+
−
{{#set: common name=3-oxoadipyl-CoA}}
+
−
{{#set: molecular weight=904.605    }}
+
−
{{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}}
+
−
{{#set: consumed or produced by=RXN0-2044}}
+

Latest revision as of 19:59, 21 March 2018

Gene Ec-02_001820

  • Synonym(s):
    • Esi_0055_0072
    • Esi0055_0072

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_001820&oldid=30807"