Difference between revisions of "CPD-16953"

Latest revision as of 20:59, 21 March 2018

"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphorylated-pyruvate-dehydrogenases Phosphorylated-pyruvate-dehydrogenases] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] ==
+* smiles:
+** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
+* inchi key:
+** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
 * common name:
-** a phosphorylated pyruvate dehydrogenase
+** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
+* molecular weight:
+** 223.234
 * Synonym(s):
-** [pyruvate dehydrogenase (acetyl-transferring)] phosphate
 == Reaction(s) known to consume the compound ==
+* [[RXN-15733]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-* [[2.7.11.2-RXN]]
 == External links  ==
-{{#set: common name=a phosphorylated pyruvate dehydrogenase}}
+* PUBCHEM:
-{{#set: common name=[pyruvate dehydrogenase (acetyl-transferring)] phosphate}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804]
-{{#set: reversible reaction associated=2.7.11.2-RXN}}
+{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}}
+{{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}}
+{{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
+{{#set: molecular weight=223.234    }}
+{{#set: consumed by=RXN-15733}}