Difference between revisions of "S-ubiquitinyl-HECT-E3-UCP-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] == * common name: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] ==
* smiles:
+
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)
+
* inchi key:
+
** InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J
+
 
* common name:
 
* common name:
** D-myo-inositol (3,4)-bisphosphate
+
** an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine
* molecular weight:
+
** 336.085   
+
 
* Synonym(s):
 
* Synonym(s):
** 1D-myo-inositol (3,4)-bisphosphate
 
** inositol (3,4)-bisphosphate
 
** (2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid
 
** Ins(3,4)P2
 
** I(3,4)P2
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15560]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10939]]
+
* [[RXN-15559]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21120281 21120281]
+
{{#set: consumed by=RXN-15560}}
* CHEMSPIDER:
+
{{#set: produced by=RXN-15559}}
** [http://www.chemspider.com/Chemical-Structure.19980559.html 19980559]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83241 83241]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04063 C04063]
+
* HMDB : HMDB06235
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)}}
+
{{#set: inchi key=InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J}}
+
{{#set: common name=D-myo-inositol (3,4)-bisphosphate}}
+
{{#set: molecular weight=336.085    }}
+
{{#set: common name=1D-myo-inositol (3,4)-bisphosphate|inositol (3,4)-bisphosphate|(2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid|Ins(3,4)P2|I(3,4)P2}}
+
{{#set: produced by=RXN-10939}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine

  • common name:
    • an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine" cannot be used as a page name in this wiki.