Difference between revisions of "3-HYDROXY-ISOVALERYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * smiles: ** CC(COP(=O)([O-])OP(=O)([O-])...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J |
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyisovaleryl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 863.619 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-hydroxy-isovaleryl-coa |
− | + | ** 3-hydroxy-iso-valeryl-CoA | |
− | + | ||
− | ** | + | |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14266]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203667 25203667] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555] |
− | + | {{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=3-hydroxyisovaleryl-CoA}} |
− | {{#set: common name= | + | {{#set: molecular weight=863.619 }} |
− | {{#set: molecular weight= | + | {{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}} |
− | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-14266}} |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite 3-HYDROXY-ISOVALERYL-COA
- smiles:
- CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O
- inchi key:
- InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J
- common name:
- 3-hydroxyisovaleryl-CoA
- molecular weight:
- 863.619
- Synonym(s):
- 3-hydroxy-isovaleryl-coa
- 3-hydroxy-iso-valeryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O" cannot be used as a page name in this wiki.