Difference between revisions of "Phosphorylated-pyruvate-dehydrogenases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * smiles: ** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-] * inchi key: ** InChIKey=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphorylated-pyruvate-dehydrogenases Phosphorylated-pyruvate-dehydrogenases] == * common name...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphorylated-pyruvate-dehydrogenases Phosphorylated-pyruvate-dehydrogenases] ==
* smiles:
+
** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L
+
 
* common name:
 
* common name:
** 2,4-dihydroxyhept-2-enedioate
+
** a phosphorylated pyruvate dehydrogenase
* molecular weight:
+
** 188.137   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** [pyruvate dehydrogenase (acetyl-transferring)] phosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14146]]
+
* [[2.7.11.2-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a phosphorylated pyruvate dehydrogenase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54724344 54724344]
+
{{#set: common name=[pyruvate dehydrogenase (acetyl-transferring)] phosphate}}
* CHEBI:
+
{{#set: reversible reaction associated=2.7.11.2-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58936 58936]
+
{{#set: smiles=C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L}}
+
{{#set: common name=2,4-dihydroxyhept-2-enedioate}}
+
{{#set: molecular weight=188.137    }}
+
{{#set: consumed or produced by=RXN-14146}}
+

Latest revision as of 21:00, 21 March 2018

Metabolite Phosphorylated-pyruvate-dehydrogenases

  • common name:
    • a phosphorylated pyruvate dehydrogenase
  • Synonym(s):
    • [pyruvate dehydrogenase (acetyl-transferring)] phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"pyruvate dehydrogenase (acetyl-transferring)] phosphate" cannot be used as a page name in this wiki.