Difference between revisions of "Phosphorylated-pyruvate-dehydrogenases"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * smiles: ** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphorylated-pyruvate-dehydrogenases Phosphorylated-pyruvate-dehydrogenases] == * common name...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphorylated-pyruvate-dehydrogenases Phosphorylated-pyruvate-dehydrogenases] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a phosphorylated pyruvate dehydrogenase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** [pyruvate dehydrogenase (acetyl-transferring)] phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[2.7.11.2-RXN]] |
== External links == | == External links == | ||
− | + | {{#set: common name=a phosphorylated pyruvate dehydrogenase}} | |
− | + | {{#set: common name=[pyruvate dehydrogenase (acetyl-transferring)] phosphate}} | |
− | + | {{#set: reversible reaction associated=2.7.11.2-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 21:00, 21 March 2018
Contents
Metabolite Phosphorylated-pyruvate-dehydrogenases
- common name:
- a phosphorylated pyruvate dehydrogenase
- Synonym(s):
- [pyruvate dehydrogenase (acetyl-transferring)] phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"pyruvate dehydrogenase (acetyl-transferring)] phosphate" cannot be used as a page name in this wiki.