Difference between revisions of "CPD-15125"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6-L-threonylcarbamoyladenine37-tRNAs N6-L-threonylcarbamoyladenine37-tRNAs] == * common name:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * smiles: ** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-] * inchi key: ** InChIKey=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6-L-threonylcarbamoyladenine37-tRNAs N6-L-threonylcarbamoyladenine37-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] ==
 +
* smiles:
 +
** C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L
 
* common name:
 
* common name:
** N6-L-threonylcarbamoyladenine37 in tRNA
+
** 2,4-dihydroxyhept-2-enedioate
 +
* molecular weight:
 +
** 188.137   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14570]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14146]]
 
== External links  ==
 
== External links  ==
{{#set: common name=N6-L-threonylcarbamoyladenine37 in tRNA}}
+
* PUBCHEM:
{{#set: produced by=RXN-14570}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54724344 54724344]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58936 58936]
 +
{{#set: smiles=C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L}}
 +
{{#set: common name=2,4-dihydroxyhept-2-enedioate}}
 +
{{#set: molecular weight=188.137    }}
 +
{{#set: reversible reaction associated=RXN-14146}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-15125

  • smiles:
    • C(=O)([O-])CCC(O)C=C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=APNIDHDQYISZAE-HYXAFXHYSA-L
  • common name:
    • 2,4-dihydroxyhept-2-enedioate
  • molecular weight:
    • 188.137
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CCC(O)C=C(O)C(=O)[O-" cannot be used as a page name in this wiki.