Difference between revisions of "N6-L-threonylcarbamoyladenine37-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6-L-threonylcarbamoyladenine37-tRNAs N6-L-threonylcarbamoyladenine37-tRNAs] == * common name:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6-L-threonylcarbamoyladenine37-tRNAs N6-L-threonylcarbamoyladenine37-tRNAs] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))
+
* inchi key:
+
** InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L
+
 
* common name:
 
* common name:
** GDP-α-D-glucose
+
** N6-L-threonylcarbamoyladenine37 in tRNA
* molecular weight:
+
** 603.329   
+
 
* Synonym(s):
 
* Synonym(s):
** GDP-glucose
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.36-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-12486]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=N6-L-threonylcarbamoyladenine37 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921606 52921606]
+
{{#set: produced by=RXN-14570}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62230 62230]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00394 C00394]
+
* HMDB : HMDB03351
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))}}
+
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L}}
+
{{#set: common name=GDP-α-D-glucose}}
+
{{#set: molecular weight=603.329    }}
+
{{#set: common name=GDP-glucose}}
+
{{#set: consumed by=2.4.1.36-RXN}}
+
{{#set: reversible reaction associated=RXN-12486}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite N6-L-threonylcarbamoyladenine37-tRNAs

  • common name:
    • N6-L-threonylcarbamoyladenine37 in tRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links