Difference between revisions of "GDP-D-GLUCOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L |
* common name: | * common name: | ||
− | ** | + | ** GDP-α-D-glucose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 603.329 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GDP-glucose |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.36-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-12486]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921606 52921606] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62230 62230] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00394 C00394] |
− | {{#set: common name= | + | * HMDB : HMDB03351 |
− | {{#set: molecular weight= | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L}} |
− | {{#set: consumed by= | + | {{#set: common name=GDP-α-D-glucose}} |
− | {{#set: | + | {{#set: molecular weight=603.329 }} |
+ | {{#set: common name=GDP-glucose}} | ||
+ | {{#set: consumed by=2.4.1.36-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-12486}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite GDP-D-GLUCOSE
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L
- common name:
- GDP-α-D-glucose
- molecular weight:
- 603.329
- Synonym(s):
- GDP-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))" cannot be used as a page name in this wiki.