Difference between revisions of "Crotonyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Crotonyl-ACPs Crotonyl-ACPs] == * common name: ** a crotonyl-[acp] * Synonym(s): ** a trans-but...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-D-GLUCOSE GDP-D-GLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Crotonyl-ACPs Crotonyl-ACPs] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))
+
* inchi key:
+
** InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L
+
 
* common name:
 
* common name:
** GDP-α-D-glucose
+
** a crotonyl-[acp]
* molecular weight:
+
** 603.329   
+
 
* Synonym(s):
 
* Synonym(s):
** GDP-glucose
+
** a trans-but-2-enoyl-[acp]
 +
** a (2E)-but-2-enoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.36-RXN]]
+
* [[RXN-9657]]
 +
* [[RXN-9515]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4.2.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-12486]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a crotonyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921606 52921606]
+
{{#set: common name=a trans-but-2-enoyl-[acp]|a (2E)-but-2-enoyl-[acp]}}
* CHEBI:
+
{{#set: consumed by=RXN-9657|RXN-9515}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62230 62230]
+
{{#set: produced by=4.2.1.58-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00394 C00394]
+
* HMDB : HMDB03351
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OP([O-])(=O)OP([O-])(=O)OCC2(C(O)C(O)C(O2)N3(C=NC4(=C3N=C(N)NC(=O)4))))}}
+
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-LRJDVEEWSA-L}}
+
{{#set: common name=GDP-α-D-glucose}}
+
{{#set: molecular weight=603.329    }}
+
{{#set: common name=GDP-glucose}}
+
{{#set: consumed by=2.4.1.36-RXN}}
+
{{#set: reversible reaction associated=RXN-12486}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite Crotonyl-ACPs

  • common name:
    • a crotonyl-[acp]
  • Synonym(s):
    • a trans-but-2-enoyl-[acp]
    • a (2E)-but-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a crotonyl-[acp" cannot be used as a page name in this wiki.
  • "a trans-but-2-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a (2E)-but-2-enoyl-[acp" cannot be used as a page name in this wiki.