Difference between revisions of "Crotonyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * smiles: ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Crotonyl-ACPs Crotonyl-ACPs] == * common name: ** a crotonyl-[acp] * Synonym(s): ** a trans-but...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Crotonyl-ACPs Crotonyl-ACPs] ==
−
* smiles:
+
−
** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
+
−
* inchi key:
+
−
** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D
+
 
* common name:
 
* common name:
−
** D-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** a crotonyl-[acp]
−
* molecular weight:
+
−
** 569.977   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4,5,6)P5
+
** a trans-but-2-enoyl-[acp]
−
** 1D-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** a (2E)-but-2-enoyl-[acp]
−
** inositol 1,3,4,5,6-pentakisphosphate
+
−
** I(1,3,4,5,6)P5
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10955]]
+
* [[RXN-9657]]
−
* [[RXN-7163]]
+
* [[RXN-9515]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.7.1.134-RXN]]
+
* [[4.2.1.58-RXN]]
−
* [[2.7.1.140-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a crotonyl-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01284 C01284]
+
{{#set: common name=a trans-but-2-enoyl-[acp]|a (2E)-but-2-enoyl-[acp]}}
−
* CHEBI:
+
{{#set: consumed by=RXN-9657|RXN-9515}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570]
+
{{#set: produced by=4.2.1.58-RXN}}
−
* METABOLIGHTS : MTBLC57733
+
−
* HMDB : HMDB03529
+
−
{{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}}
+
−
{{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}}
+
−
{{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}}
+
−
{{#set: molecular weight=569.977    }}
+
−
{{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}}
+
−
{{#set: consumed by=RXN-10955|RXN-7163}}
+
−
{{#set: produced by=2.7.1.134-RXN|2.7.1.140-RXN}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite Crotonyl-ACPs

  • common name:
    • a crotonyl-[acp]
  • Synonym(s):
    • a trans-but-2-enoyl-[acp]
    • a (2E)-but-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a crotonyl-[acp" cannot be used as a page name in this wiki.
  • "a trans-but-2-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a (2E)-but-2-enoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Crotonyl-ACPs&oldid=30896"