Difference between revisions of "CPD-1107"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-MALEYL-ACETOACETATE 4-MALEYL-ACETOACETATE] == * smiles: ** C([O-])(=O)C=CC(=O)CC(=O)CC([O-])=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * smiles: ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == |
* smiles: | * smiles: | ||
| − | ** C([O-])(=O)C= | + | ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D |
* common name: | * common name: | ||
| − | ** | + | ** D-myo-inositol 1,3,4,5,6-pentakisphosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 569.977 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Ins(1,3,4,5,6)P5 | ||
| + | ** 1D-myo-inositol 1,3,4,5,6-pentakisphosphate | ||
| + | ** inositol 1,3,4,5,6-pentakisphosphate | ||
| + | ** I(1,3,4,5,6)P5 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10955]] | ||
| + | * [[RXN-7163]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.1.134-RXN]] |
| + | * [[2.7.1.140-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01284 C01284] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57733 |
| − | {{#set: smiles=C([O-])(=O)C= | + | * HMDB : HMDB03529 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}} |
| − | {{#set: molecular weight= | + | {{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}} |
| − | {{#set: | + | {{#set: molecular weight=569.977 }} |
| + | {{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}} | ||
| + | {{#set: consumed by=RXN-10955|RXN-7163}} | ||
| + | {{#set: produced by=2.7.1.134-RXN|2.7.1.140-RXN}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-1107
- smiles:
- C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- inchi key:
- InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D
- common name:
- D-myo-inositol 1,3,4,5,6-pentakisphosphate
- molecular weight:
- 569.977
- Synonym(s):
- Ins(1,3,4,5,6)P5
- 1D-myo-inositol 1,3,4,5,6-pentakisphosphate
- inositol 1,3,4,5,6-pentakisphosphate
- I(1,3,4,5,6)P5
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.
