Difference between revisions of "Apo-Transcarboxylases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * smiles: ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=apo-Transcarboxylases apo-Transcarboxylases] == * common name: ** an apo-[methylmalonyl-CoA:pyr...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=apo-Transcarboxylases apo-Transcarboxylases] ==
* smiles:
+
** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
+
 
* common name:
 
* common name:
** 5-methylhex-4-enoyl-CoA
+
** an apo-[methylmalonyl-CoA:pyruvate carboxytransferase]
* molecular weight:
+
** 873.658   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** apo-[methylmalonyl-CoA-carboxyltransferase]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6.3.4.9-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11917]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an apo-[methylmalonyl-CoA:pyruvate carboxytransferase]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986179 50986179]
+
{{#set: common name=apo-[methylmalonyl-CoA-carboxyltransferase]}}
* LIGAND-CPD:
+
{{#set: consumed by=6.3.4.9-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C16470 C16470]
+
{{#set: smiles=CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J}}
+
{{#set: common name=5-methylhex-4-enoyl-CoA}}
+
{{#set: molecular weight=873.658    }}
+
{{#set: produced by=RXN-11917}}
+

Latest revision as of 21:00, 21 March 2018

Metabolite apo-Transcarboxylases

  • common name:
    • an apo-[methylmalonyl-CoA:pyruvate carboxytransferase]
  • Synonym(s):
    • apo-[methylmalonyl-CoA-carboxyltransferase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an apo-[methylmalonyl-CoA:pyruvate carboxytransferase" cannot be used as a page name in this wiki.
"apo-[methylmalonyl-CoA-carboxyltransferase" cannot be used as a page name in this wiki.