Difference between revisions of "CPD-12902"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16015 CPD-16015] == * smiles: ** CC(=N)C(=O)[O-] * inchi key: ** InChIKey=DUAWRLXHCUAWMK-UH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * smiles: ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == |
* smiles: | * smiles: | ||
− | ** CC(= | + | ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J |
* common name: | * common name: | ||
− | ** | + | ** 5-methylhex-4-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 873.658 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11917]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986179 50986179] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16470 C16470] |
− | {{#set: smiles=CC(= | + | {{#set: smiles=CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J}} |
− | {{#set: common name= | + | {{#set: common name=5-methylhex-4-enoyl-CoA}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=873.658 }} |
− | + | {{#set: produced by=RXN-11917}} | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-12902
- smiles:
- CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
- common name:
- 5-methylhex-4-enoyl-CoA
- molecular weight:
- 873.658
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.